C22H35N3 — CID 99932282
1-methyl-4-[(3R)-1-[(Z)-5-methyl-2-phenylhex-2-enyl]pyrrolidin-3-yl]piperazine (PubChem CID 99932282) has the molecular formula C22H35N3 and a molecular weight of 341.54 g/mol. Its IUPAC name is 1-methyl-4-[(3R)-1-[(Z)-5-methyl-2-phenylhex-2-enyl]pyrrolidin-3-yl]piperazine.
| Compound Name | 1-methyl-4-[(3R)-1-[(Z)-5-methyl-2-phenylhex-2-enyl]pyrrolidin-3-yl]piperazine |
|---|---|
| PubChem CID | 99932282 |
| Molecular Formula | C22H35N3 |
| Molecular Weight | 341.54 g/mol |
| Exact Mass | 341.28 |
| IUPAC Name | 1-methyl-4-[(3R)-1-[(Z)-5-methyl-2-phenylhex-2-enyl]pyrrolidin-3-yl]piperazine |
| SMILES | CC(C)C/C=C(\CN1CC[C@@H](N2CCN(C)CC2)C1)c1ccccc1 |
| InChI | InChI=1S/C22H35N3/c1-19(2)9-10-21(20-7-5-4-6-8-20)17-24-12-11-22(18-24)25-15-13-23(3)14-16-25/h4-8,10,19,22H,9,11-18H2,1-3H3/b21-10+/t22-/m1/s1 |
| InChIKey | DILTXDVQQGZZAP-DZEJHBHFSA-N |
| XLogP | 3.44 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.54 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |