C13H18ClN5O2 — CID 99932464
1-[(3S)-1-(3-amino-4-chloro-1H-pyrazole-5-carbonyl)piperidin-3-yl]pyrrolidin-2-one (PubChem CID 99932464) has the molecular formula C13H18ClN5O2 and a molecular weight of 311.77 g/mol. Its IUPAC name is 1-[(3S)-1-(3-amino-4-chloro-1H-pyrazole-5-carbonyl)piperidin-3-yl]pyrrolidin-2-one.
| Compound Name | 1-[(3S)-1-(3-amino-4-chloro-1H-pyrazole-5-carbonyl)piperidin-3-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 99932464 |
| Molecular Formula | C13H18ClN5O2 |
| Molecular Weight | 311.77 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 1-[(3S)-1-(3-amino-4-chloro-1H-pyrazole-5-carbonyl)piperidin-3-yl]pyrrolidin-2-one |
| SMILES | Nc1n[nH]c(C(=O)N2CCC[C@H](N3CCCC3=O)C2)c1Cl |
| InChI | InChI=1S/C13H18ClN5O2/c14-10-11(16-17-12(10)15)13(21)18-5-1-3-8(7-18)19-6-2-4-9(19)20/h8H,1-7H2,(H3,15,16,17)/t8-/m0/s1 |
| InChIKey | ZPFKWMJPDGHJNV-QMMMGPOBSA-N |
| XLogP | 0.87 |
| TPSA | 95.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.77 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |