C17H19ClN4O2 — CID 99933934
(9aR)-2-(4-chloro-1-methylindole-2-carbonyl)-3,4,6,7,8,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-9-one (PubChem CID 99933934) has the molecular formula C17H19ClN4O2 and a molecular weight of 346.82 g/mol. Its IUPAC name is (9aR)-2-(4-chloro-1-methylindole-2-carbonyl)-3,4,6,7,8,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-9-one.
| Compound Name | (9aR)-2-(4-chloro-1-methylindole-2-carbonyl)-3,4,6,7,8,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-9-one |
|---|---|
| PubChem CID | 99933934 |
| Molecular Formula | C17H19ClN4O2 |
| Molecular Weight | 346.82 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | (9aR)-2-(4-chloro-1-methylindole-2-carbonyl)-3,4,6,7,8,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-9-one |
| SMILES | Cn1c(C(=O)N2CCN3CCNC(=O)[C@H]3C2)cc2c(Cl)cccc21 |
| InChI | InChI=1S/C17H19ClN4O2/c1-20-13-4-2-3-12(18)11(13)9-14(20)17(24)22-8-7-21-6-5-19-16(23)15(21)10-22/h2-4,9,15H,5-8,10H2,1H3,(H,19,23)/t15-/m1/s1 |
| InChIKey | SPDPBSZTNBYAEV-OAHLLOKOSA-N |
| XLogP | 1.09 |
| TPSA | 57.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.82 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |