C16H19ClN2O3 — CID 56738217
(4-chloro-1-methylindol-2-yl)-[4-hydroxy-4-(hydroxymethyl)piperidin-1-yl]methanone (PubChem CID 56738217) has the molecular formula C16H19ClN2O3 and a molecular weight of 322.79 g/mol. Its IUPAC name is (4-chloro-1-methylindol-2-yl)-[4-hydroxy-4-(hydroxymethyl)piperidin-1-yl]methanone.
| Compound Name | (4-chloro-1-methylindol-2-yl)-[4-hydroxy-4-(hydroxymethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 56738217 |
| Molecular Formula | C16H19ClN2O3 |
| Molecular Weight | 322.79 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | (4-chloro-1-methylindol-2-yl)-[4-hydroxy-4-(hydroxymethyl)piperidin-1-yl]methanone |
| SMILES | Cn1c(C(=O)N2CCC(O)(CO)CC2)cc2c(Cl)cccc21 |
| InChI | InChI=1S/C16H19ClN2O3/c1-18-13-4-2-3-12(17)11(13)9-14(18)15(21)19-7-5-16(22,10-20)6-8-19/h2-4,9,20,22H,5-8,10H2,1H3 |
| InChIKey | PXJKVIDEVQAPQQ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 65.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.79 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |