C22H34O3 — CID 99937681
1-[(1R,2S,4R,6S,7S,10S,11S,14S,16R)-14-hydroxy-4,7,11-trimethyl-5-oxapentacyclo[8.8.0.02,7.04,6.011,16]octadecan-6-yl]ethanone (PubChem CID 99937681) has the molecular formula C22H34O3 and a molecular weight of 346.51 g/mol. Its IUPAC name is 1-[(1R,2S,4R,6S,7S,10S,11S,14S,16R)-14-hydroxy-4,7,11-trimethyl-5-oxapentacyclo[8.8.0.02,7.04,6.011,16]octadecan-6-yl]ethanone.
| Compound Name | 1-[(1R,2S,4R,6S,7S,10S,11S,14S,16R)-14-hydroxy-4,7,11-trimethyl-5-oxapentacyclo[8.8.0.02,7.04,6.011,16]octadecan-6-yl]ethanone |
|---|---|
| PubChem CID | 99937681 |
| Molecular Formula | C22H34O3 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | 1-[(1R,2S,4R,6S,7S,10S,11S,14S,16R)-14-hydroxy-4,7,11-trimethyl-5-oxapentacyclo[8.8.0.02,7.04,6.011,16]octadecan-6-yl]ethanone |
| SMILES | CC(=O)[C@@]12O[C@]1(C)C[C@H]1[C@@H]3CC[C@@H]4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@@]12C |
| InChI | InChI=1S/C22H34O3/c1-13(23)22-20(3)10-8-17-16(18(20)12-21(22,4)25-22)6-5-14-11-15(24)7-9-19(14,17)2/h14-18,24H,5-12H2,1-4H3/t14-,15+,16-,17+,18+,19+,20+,21-,22+/m1/s1 |
| InChIKey | CBOGURZXXNBKGU-PGMVTGOWSA-N |
| XLogP | 4.12 |
| TPSA | 49.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|