C8H19N3 — CID 99942865
(3S,4R)-3-(aminomethyl)-1-ethylpiperidin-4-amine (PubChem CID 99942865) has the molecular formula C8H19N3 and a molecular weight of 157.26 g/mol. Its IUPAC name is (3S,4R)-3-(aminomethyl)-1-ethylpiperidin-4-amine.
| Compound Name | (3S,4R)-3-(aminomethyl)-1-ethylpiperidin-4-amine |
|---|---|
| PubChem CID | 99942865 |
| Molecular Formula | C8H19N3 |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.16 |
| IUPAC Name | (3S,4R)-3-(aminomethyl)-1-ethylpiperidin-4-amine |
| SMILES | CCN1CC[C@@H](N)[C@@H](CN)C1 |
| InChI | InChI=1S/C8H19N3/c1-2-11-4-3-8(10)7(5-9)6-11/h7-8H,2-6,9-10H2,1H3/t7-,8+/m0/s1 |
| InChIKey | BFUUGWKTMQRESV-JGVFFNPUSA-N |
| XLogP | -0.39 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |