C11H22N2 — CID 154351427
2-ethyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-5-amine (PubChem CID 154351427) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is 2-ethyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-5-amine.
| Compound Name | 2-ethyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-5-amine |
|---|---|
| PubChem CID | 154351427 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | 2-ethyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-5-amine |
| SMILES | CCN1CCC2C(N)CCCC2C1 |
| InChI | InChI=1S/C11H22N2/c1-2-13-7-6-10-9(8-13)4-3-5-11(10)12/h9-11H,2-8,12H2,1H3 |
| InChIKey | MVIUWRRFLNBOOB-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |