C18H27N5 — CID 99948001
(2S)-1-[(5-methyl-1-prop-2-enylpyrazol-4-yl)methyl]-2-(2-pyrazol-1-ylethyl)piperidine (PubChem CID 99948001) has the molecular formula C18H27N5 and a molecular weight of 313.45 g/mol. Its IUPAC name is (2S)-1-[(5-methyl-1-prop-2-enylpyrazol-4-yl)methyl]-2-(2-pyrazol-1-ylethyl)piperidine.
| Compound Name | (2S)-1-[(5-methyl-1-prop-2-enylpyrazol-4-yl)methyl]-2-(2-pyrazol-1-ylethyl)piperidine |
|---|---|
| PubChem CID | 99948001 |
| Molecular Formula | C18H27N5 |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.23 |
| IUPAC Name | (2S)-1-[(5-methyl-1-prop-2-enylpyrazol-4-yl)methyl]-2-(2-pyrazol-1-ylethyl)piperidine |
| SMILES | C=CCn1ncc(CN2CCCC[C@H]2CCn2cccn2)c1C |
| InChI | InChI=1S/C18H27N5/c1-3-10-23-16(2)17(14-20-23)15-21-11-5-4-7-18(21)8-13-22-12-6-9-19-22/h3,6,9,12,14,18H,1,4-5,7-8,10-11,13,15H2,2H3/t18-/m0/s1 |
| InChIKey | SCZVQFVGHPJGAI-SFHVURJKSA-N |
| XLogP | 3.02 |
| TPSA | 38.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|