C21H19F2N3O2 — CID 99948880
(3S)-4-(5-fluoro-1,3-dimethylindole-2-carbonyl)-3-(4-fluorophenyl)piperazin-2-one (PubChem CID 99948880) has the molecular formula C21H19F2N3O2 and a molecular weight of 383.40 g/mol. Its IUPAC name is (3S)-4-(5-fluoro-1,3-dimethylindole-2-carbonyl)-3-(4-fluorophenyl)piperazin-2-one.
| Compound Name | (3S)-4-(5-fluoro-1,3-dimethylindole-2-carbonyl)-3-(4-fluorophenyl)piperazin-2-one |
|---|---|
| PubChem CID | 99948880 |
| Molecular Formula | C21H19F2N3O2 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | (3S)-4-(5-fluoro-1,3-dimethylindole-2-carbonyl)-3-(4-fluorophenyl)piperazin-2-one |
| SMILES | Cc1c(C(=O)N2CCNC(=O)[C@@H]2c2ccc(F)cc2)n(C)c2ccc(F)cc12 |
| InChI | InChI=1S/C21H19F2N3O2/c1-12-16-11-15(23)7-8-17(16)25(2)18(12)21(28)26-10-9-24-20(27)19(26)13-3-5-14(22)6-4-13/h3-8,11,19H,9-10H2,1-2H3,(H,24,27)/t19-/m0/s1 |
| InChIKey | YEGDRKFKWGTBJU-IBGZPJMESA-N |
| XLogP | 3.08 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|