C20H24FN3 — CID 99950270
2-cyclohexyl-5-[[(2S)-2-(4-fluorophenyl)azetidin-1-yl]methyl]pyrimidine (PubChem CID 99950270) has the molecular formula C20H24FN3 and a molecular weight of 325.43 g/mol. Its IUPAC name is 2-cyclohexyl-5-[[(2S)-2-(4-fluorophenyl)azetidin-1-yl]methyl]pyrimidine.
| Compound Name | 2-cyclohexyl-5-[[(2S)-2-(4-fluorophenyl)azetidin-1-yl]methyl]pyrimidine |
|---|---|
| PubChem CID | 99950270 |
| Molecular Formula | C20H24FN3 |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | 2-cyclohexyl-5-[[(2S)-2-(4-fluorophenyl)azetidin-1-yl]methyl]pyrimidine |
| SMILES | Fc1ccc([C@@H]2CCN2Cc2cnc(C3CCCCC3)nc2)cc1 |
| InChI | InChI=1S/C20H24FN3/c21-18-8-6-16(7-9-18)19-10-11-24(19)14-15-12-22-20(23-13-15)17-4-2-1-3-5-17/h6-9,12-13,17,19H,1-5,10-11,14H2/t19-/m0/s1 |
| InChIKey | JTKKEJFZZGYFCN-IBGZPJMESA-N |
| XLogP | 4.61 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |