C17H20N4 — CID 136547341
2-cyclopropyl-5-[(2-pyridin-3-ylpyrrolidin-1-yl)methyl]pyrimidine (PubChem CID 136547341) has the molecular formula C17H20N4 and a molecular weight of 280.37 g/mol. Its IUPAC name is 2-cyclopropyl-5-[(2-pyridin-3-ylpyrrolidin-1-yl)methyl]pyrimidine.
| Compound Name | 2-cyclopropyl-5-[(2-pyridin-3-ylpyrrolidin-1-yl)methyl]pyrimidine |
|---|---|
| PubChem CID | 136547341 |
| Molecular Formula | C17H20N4 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 2-cyclopropyl-5-[(2-pyridin-3-ylpyrrolidin-1-yl)methyl]pyrimidine |
| SMILES | c1cncc(C2CCCN2Cc2cnc(C3CC3)nc2)c1 |
| InChI | InChI=1S/C17H20N4/c1-3-15(11-18-7-1)16-4-2-8-21(16)12-13-9-19-17(20-10-13)14-5-6-14/h1,3,7,9-11,14,16H,2,4-6,8,12H2 |
| InChIKey | BSYYNHPEBGVQFB-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |