C20H17Cl2NO2 — CID 99954003
(2R)-N-(2,4-dichlorophenyl)-2-naphthalen-1-yloxybutanamide (PubChem CID 99954003) has the molecular formula C20H17Cl2NO2 and a molecular weight of 374.27 g/mol. Its IUPAC name is (2R)-N-(2,4-dichlorophenyl)-2-naphthalen-1-yloxybutanamide.
| Compound Name | (2R)-N-(2,4-dichlorophenyl)-2-naphthalen-1-yloxybutanamide |
|---|---|
| PubChem CID | 99954003 |
| Molecular Formula | C20H17Cl2NO2 |
| Molecular Weight | 374.27 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | (2R)-N-(2,4-dichlorophenyl)-2-naphthalen-1-yloxybutanamide |
| SMILES | CC[C@@H](Oc1cccc2ccccc12)C(=O)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H17Cl2NO2/c1-2-18(20(24)23-17-11-10-14(21)12-16(17)22)25-19-9-5-7-13-6-3-4-8-15(13)19/h3-12,18H,2H2,1H3,(H,23,24)/t18-/m1/s1 |
| InChIKey | VLDXGLDCALYIKT-GOSISDBHSA-N |
| XLogP | 5.94 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.27 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |