About methyl (2R)-2-amino-2-[(1S,3S)-3-methoxycyclohexyl]acetate
methyl (2R)-2-amino-2-[(1S,3S)-3-methoxycyclohexyl]acetate (PubChem CID 99955390) has the molecular formula C10H19NO3
and a molecular weight of 201.27 g/mol. Its IUPAC name is methyl (2R)-2-amino-2-[(1S,3S)-3-methoxycyclohexyl]acetate.
Molecular Properties
| Compound Name | methyl (2R)-2-amino-2-[(1S,3S)-3-methoxycyclohexyl]acetate |
| PubChem CID | 99955390 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | methyl (2R)-2-amino-2-[(1S,3S)-3-methoxycyclohexyl]acetate |
| SMILES | COC(=O)[C@H](N)[C@H]1CCC[C@H](OC)C1 |
| InChI | InChI=1S/C10H19NO3/c1-13-8-5-3-4-7(6-8)9(11)10(12)14-2/h7-9H,3-6,11H2,1-2H3/t7-,8-,9+/m0/s1 |
| InChIKey | CDLZCXGMABRRCJ-XHNCKOQMSA-N |
| XLogP | 0.69 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl (2R)-2-amino-2-[(1S,3S)-3-methoxycyclohexyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2R)-2-amino-2-[(1S,3S)-3-methoxycyclohexyl]acetate?
The IUPAC name of methyl (2R)-2-amino-2-[(1S,3S)-3-methoxycyclohexyl]acetate (CID 99955390) is methyl (2R)-2-amino-2-[(1S,3S)-3-methoxycyclohexyl]acetate.
What is the SMILES notation for methyl (2R)-2-amino-2-[(1S,3S)-3-methoxycyclohexyl]acetate?
The canonical SMILES for methyl (2R)-2-amino-2-[(1S,3S)-3-methoxycyclohexyl]acetate is COC(=O)[C@H](N)[C@H]1CCC[C@H](OC)C1.
What is the InChIKey of methyl (2R)-2-amino-2-[(1S,3S)-3-methoxycyclohexyl]acetate?
The InChIKey is CDLZCXGMABRRCJ-XHNCKOQMSA-N. The full InChI is InChI=1S/C10H19NO3/c1-13-8-5-3-4-7(6-8)9(11)10(12)14-2/h7-9H,3-6,11H2,1-2H3/t7-,8-,9+/m0/s1.
What are the key properties of methyl (2R)-2-amino-2-[(1S,3S)-3-methoxycyclohexyl]acetate?
methyl (2R)-2-amino-2-[(1S,3S)-3-methoxycyclohexyl]acetate has a molecular weight of 201.27 g/mol, XLogP of 0.69, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R)-2-amino-2-[(1S,3S)-3-methoxycyclohexyl]acetate is sourced from PubChem (CID 99955390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).