C17H27NO3 — CID 99955836
(3R)-1-[(2,4-dimethoxyphenyl)methyl]-3-propoxypiperidine (PubChem CID 99955836) has the molecular formula C17H27NO3 and a molecular weight of 293.41 g/mol. Its IUPAC name is (3R)-1-[(2,4-dimethoxyphenyl)methyl]-3-propoxypiperidine.
| Compound Name | (3R)-1-[(2,4-dimethoxyphenyl)methyl]-3-propoxypiperidine |
|---|---|
| PubChem CID | 99955836 |
| Molecular Formula | C17H27NO3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | (3R)-1-[(2,4-dimethoxyphenyl)methyl]-3-propoxypiperidine |
| SMILES | CCCO[C@@H]1CCCN(Cc2ccc(OC)cc2OC)C1 |
| InChI | InChI=1S/C17H27NO3/c1-4-10-21-16-6-5-9-18(13-16)12-14-7-8-15(19-2)11-17(14)20-3/h7-8,11,16H,4-6,9-10,12-13H2,1-3H3/t16-/m1/s1 |
| InChIKey | VCTSCSXIEMZWBB-MRXNPFEDSA-N |
| XLogP | 3.09 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |