C15H23FN2O — CID 54985711
4-fluoro-2-[(3-propoxypiperidin-1-yl)methyl]aniline (PubChem CID 54985711) has the molecular formula C15H23FN2O and a molecular weight of 266.36 g/mol. Its IUPAC name is 4-fluoro-2-[(3-propoxypiperidin-1-yl)methyl]aniline.
| Compound Name | 4-fluoro-2-[(3-propoxypiperidin-1-yl)methyl]aniline |
|---|---|
| PubChem CID | 54985711 |
| Molecular Formula | C15H23FN2O |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | 4-fluoro-2-[(3-propoxypiperidin-1-yl)methyl]aniline |
| SMILES | CCCOC1CCCN(Cc2cc(F)ccc2N)C1 |
| InChI | InChI=1S/C15H23FN2O/c1-2-8-19-14-4-3-7-18(11-14)10-12-9-13(16)5-6-15(12)17/h5-6,9,14H,2-4,7-8,10-11,17H2,1H3 |
| InChIKey | WWMNIPSVMOWMMN-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|