C16H21F4NO — CID 134697243
1-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]-3-propoxypiperidine (PubChem CID 134697243) has the molecular formula C16H21F4NO and a molecular weight of 319.34 g/mol. Its IUPAC name is 1-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]-3-propoxypiperidine.
| Compound Name | 1-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]-3-propoxypiperidine |
|---|---|
| PubChem CID | 134697243 |
| Molecular Formula | C16H21F4NO |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | 1-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]-3-propoxypiperidine |
| SMILES | CCCOC1CCCN(Cc2ccc(F)c(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C16H21F4NO/c1-2-8-22-13-4-3-7-21(11-13)10-12-5-6-15(17)14(9-12)16(18,19)20/h5-6,9,13H,2-4,7-8,10-11H2,1H3 |
| InChIKey | MMSORIWZIBPIPB-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |