C19H23F4N3 — CID 72873646
1-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]-3-(1-propan-2-ylimidazol-2-yl)piperidine (PubChem CID 72873646) has the molecular formula C19H23F4N3 and a molecular weight of 369.41 g/mol. Its IUPAC name is 1-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]-3-(1-propan-2-ylimidazol-2-yl)piperidine.
| Compound Name | 1-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]-3-(1-propan-2-ylimidazol-2-yl)piperidine |
|---|---|
| PubChem CID | 72873646 |
| Molecular Formula | C19H23F4N3 |
| Molecular Weight | 369.41 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | 1-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]-3-(1-propan-2-ylimidazol-2-yl)piperidine |
| SMILES | CC(C)n1ccnc1C1CCCN(Cc2ccc(F)c(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C19H23F4N3/c1-13(2)26-9-7-24-18(26)15-4-3-8-25(12-15)11-14-5-6-17(20)16(10-14)19(21,22)23/h5-7,9-10,13,15H,3-4,8,11-12H2,1-2H3 |
| InChIKey | DGIYDWWAQLOKMN-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.41 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |