C27H26N2O3S — CID 99957493
N-[(R)-(2-methylphenyl)-phenylmethyl]-2-[methylsulfonyl(naphthalen-1-yl)amino]acetamide (PubChem CID 99957493) has the molecular formula C27H26N2O3S and a molecular weight of 458.58 g/mol. Its IUPAC name is N-[(R)-(2-methylphenyl)-phenylmethyl]-2-[methylsulfonyl(naphthalen-1-yl)amino]acetamide.
| Compound Name | N-[(R)-(2-methylphenyl)-phenylmethyl]-2-[methylsulfonyl(naphthalen-1-yl)amino]acetamide |
|---|---|
| PubChem CID | 99957493 |
| Molecular Formula | C27H26N2O3S |
| Molecular Weight | 458.58 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | N-[(R)-(2-methylphenyl)-phenylmethyl]-2-[methylsulfonyl(naphthalen-1-yl)amino]acetamide |
| SMILES | Cc1ccccc1[C@H](NC(=O)CN(c1cccc2ccccc12)S(C)(=O)=O)c1ccccc1 |
| InChI | InChI=1S/C27H26N2O3S/c1-20-11-6-8-16-23(20)27(22-13-4-3-5-14-22)28-26(30)19-29(33(2,31)32)25-18-10-15-21-12-7-9-17-24(21)25/h3-18,27H,19H2,1-2H3,(H,28,30)/t27-/m1/s1 |
| InChIKey | QKWIGRUCUFRPAM-HHHXNRCGSA-N |
| XLogP | 4.82 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.58 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |