C23H29N3O4 — CID 99962480
ethyl (3S,4R)-4-[(1S)-cyclohex-3-en-1-yl]-1-(3-methoxypropyl)-2-oxo-3,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate (PubChem CID 99962480) has the molecular formula C23H29N3O4 and a molecular weight of 411.50 g/mol. Its IUPAC name is ethyl (3S,4R)-4-[(1S)-cyclohex-3-en-1-yl]-1-(3-methoxypropyl)-2-oxo-3,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate.
| Compound Name | ethyl (3S,4R)-4-[(1S)-cyclohex-3-en-1-yl]-1-(3-methoxypropyl)-2-oxo-3,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate |
|---|---|
| PubChem CID | 99962480 |
| Molecular Formula | C23H29N3O4 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | ethyl (3S,4R)-4-[(1S)-cyclohex-3-en-1-yl]-1-(3-methoxypropyl)-2-oxo-3,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C(=O)N(CCCOC)c2nc3ccccc3n2[C@@H]1[C@@H]1CC=CCC1 |
| InChI | InChI=1S/C23H29N3O4/c1-3-30-22(28)19-20(16-10-5-4-6-11-16)26-18-13-8-7-12-17(18)24-23(26)25(21(19)27)14-9-15-29-2/h4-5,7-8,12-13,16,19-20H,3,6,9-11,14-15H2,1-2H3/t16-,19+,20-/m1/s1 |
| InChIKey | LXQLQHPRFBRXQO-LSTHTHJFSA-N |
| XLogP | 3.50 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|