C16H15N3O2 — CID 99962666
2-(2-ethoxy-3-pyridinyl)-5-(3-methylphenyl)-1,3,4-oxadiazole (PubChem CID 99962666) has the molecular formula C16H15N3O2 and a molecular weight of 281.31 g/mol. Its IUPAC name is 2-(2-ethoxy-3-pyridinyl)-5-(3-methylphenyl)-1,3,4-oxadiazole.
| Compound Name | 2-(2-ethoxy-3-pyridinyl)-5-(3-methylphenyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 99962666 |
| Molecular Formula | C16H15N3O2 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 2-(2-ethoxy-3-pyridinyl)-5-(3-methylphenyl)-1,3,4-oxadiazole |
| SMILES | CCOc1ncccc1-c1nnc(-c2cccc(C)c2)o1 |
| InChI | InChI=1S/C16H15N3O2/c1-3-20-15-13(8-5-9-17-15)16-19-18-14(21-16)12-7-4-6-11(2)10-12/h4-10H,3H2,1-2H3 |
| InChIKey | IGXSEORJFKXRDW-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 61.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |