C17H27FN2O2 — CID 99963545
2-[(2S)-4-(2-ethoxyethyl)-1-[(2-fluorophenyl)methyl]piperazin-2-yl]ethanol (PubChem CID 99963545) has the molecular formula C17H27FN2O2 and a molecular weight of 310.41 g/mol. Its IUPAC name is 2-[(2S)-4-(2-ethoxyethyl)-1-[(2-fluorophenyl)methyl]piperazin-2-yl]ethanol.
| Compound Name | 2-[(2S)-4-(2-ethoxyethyl)-1-[(2-fluorophenyl)methyl]piperazin-2-yl]ethanol |
|---|---|
| PubChem CID | 99963545 |
| Molecular Formula | C17H27FN2O2 |
| Molecular Weight | 310.41 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | 2-[(2S)-4-(2-ethoxyethyl)-1-[(2-fluorophenyl)methyl]piperazin-2-yl]ethanol |
| SMILES | CCOCCN1CCN(Cc2ccccc2F)[C@@H](CCO)C1 |
| InChI | InChI=1S/C17H27FN2O2/c1-2-22-12-10-19-8-9-20(16(14-19)7-11-21)13-15-5-3-4-6-17(15)18/h3-6,16,21H,2,7-14H2,1H3/t16-/m0/s1 |
| InChIKey | KRSMHEJNKKJNEM-INIZCTEOSA-N |
| XLogP | 1.73 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.41 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|