C21H27FN2O3 — CID 51909759
2-[[(3R)-4-[(2-fluorophenyl)methyl]-3-(2-hydroxyethyl)piperazin-1-yl]methyl]-5-methoxyphenol (PubChem CID 51909759) has the molecular formula C21H27FN2O3 and a molecular weight of 374.46 g/mol. Its IUPAC name is 2-[[(3R)-4-[(2-fluorophenyl)methyl]-3-(2-hydroxyethyl)piperazin-1-yl]methyl]-5-methoxyphenol.
| Compound Name | 2-[[(3R)-4-[(2-fluorophenyl)methyl]-3-(2-hydroxyethyl)piperazin-1-yl]methyl]-5-methoxyphenol |
|---|---|
| PubChem CID | 51909759 |
| Molecular Formula | C21H27FN2O3 |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | 2-[[(3R)-4-[(2-fluorophenyl)methyl]-3-(2-hydroxyethyl)piperazin-1-yl]methyl]-5-methoxyphenol |
| SMILES | COc1ccc(CN2CCN(Cc3ccccc3F)[C@H](CCO)C2)c(O)c1 |
| InChI | InChI=1S/C21H27FN2O3/c1-27-19-7-6-17(21(26)12-19)13-23-9-10-24(18(15-23)8-11-25)14-16-4-2-3-5-20(16)22/h2-7,12,18,25-26H,8-11,13-15H2,1H3/t18-/m1/s1 |
| InChIKey | UPLKJQQIVSNXDX-GOSISDBHSA-N |
| XLogP | 2.61 |
| TPSA | 56.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|