C24H34N2O4 — CID 45203708
2-[[3-(2-hydroxyethyl)-4-[(4-methoxy-2,3-dimethylphenyl)methyl]piperazin-1-yl]methyl]-5-methoxyphenol (PubChem CID 45203708) has the molecular formula C24H34N2O4 and a molecular weight of 414.55 g/mol. Its IUPAC name is 2-[[3-(2-hydroxyethyl)-4-[(4-methoxy-2,3-dimethylphenyl)methyl]piperazin-1-yl]methyl]-5-methoxyphenol.
| Compound Name | 2-[[3-(2-hydroxyethyl)-4-[(4-methoxy-2,3-dimethylphenyl)methyl]piperazin-1-yl]methyl]-5-methoxyphenol |
|---|---|
| PubChem CID | 45203708 |
| Molecular Formula | C24H34N2O4 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.25 |
| IUPAC Name | 2-[[3-(2-hydroxyethyl)-4-[(4-methoxy-2,3-dimethylphenyl)methyl]piperazin-1-yl]methyl]-5-methoxyphenol |
| SMILES | COc1ccc(CN2CCN(Cc3ccc(OC)c(C)c3C)C(CCO)C2)c(O)c1 |
| InChI | InChI=1S/C24H34N2O4/c1-17-18(2)24(30-4)8-6-19(17)15-26-11-10-25(16-21(26)9-12-27)14-20-5-7-22(29-3)13-23(20)28/h5-8,13,21,27-28H,9-12,14-16H2,1-4H3 |
| InChIKey | CBUPTQRJUFOQDP-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 65.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|