C22H29FN2O2 — CID 45194079
2-[4-[(2-fluoro-4-methoxyphenyl)methyl]-1-[(2-methylphenyl)methyl]piperazin-2-yl]ethanol (PubChem CID 45194079) has the molecular formula C22H29FN2O2 and a molecular weight of 372.48 g/mol. Its IUPAC name is 2-[4-[(2-fluoro-4-methoxyphenyl)methyl]-1-[(2-methylphenyl)methyl]piperazin-2-yl]ethanol.
| Compound Name | 2-[4-[(2-fluoro-4-methoxyphenyl)methyl]-1-[(2-methylphenyl)methyl]piperazin-2-yl]ethanol |
|---|---|
| PubChem CID | 45194079 |
| Molecular Formula | C22H29FN2O2 |
| Molecular Weight | 372.48 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | 2-[4-[(2-fluoro-4-methoxyphenyl)methyl]-1-[(2-methylphenyl)methyl]piperazin-2-yl]ethanol |
| SMILES | COc1ccc(CN2CCN(Cc3ccccc3C)C(CCO)C2)c(F)c1 |
| InChI | InChI=1S/C22H29FN2O2/c1-17-5-3-4-6-18(17)15-25-11-10-24(16-20(25)9-12-26)14-19-7-8-21(27-2)13-22(19)23/h3-8,13,20,26H,9-12,14-16H2,1-2H3 |
| InChIKey | JEKYPZKFYLJECN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.48 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |