C14H16IN3O3S — CID 99964242
3-(2-iodophenyl)-5-[(3R)-1-methylsulfonylpiperidin-3-yl]-1,2,4-oxadiazole (PubChem CID 99964242) has the molecular formula C14H16IN3O3S and a molecular weight of 433.27 g/mol. Its IUPAC name is 3-(2-iodophenyl)-5-[(3R)-1-methylsulfonylpiperidin-3-yl]-1,2,4-oxadiazole.
| Compound Name | 3-(2-iodophenyl)-5-[(3R)-1-methylsulfonylpiperidin-3-yl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 99964242 |
| Molecular Formula | C14H16IN3O3S |
| Molecular Weight | 433.27 g/mol |
| Exact Mass | 433.00 |
| IUPAC Name | 3-(2-iodophenyl)-5-[(3R)-1-methylsulfonylpiperidin-3-yl]-1,2,4-oxadiazole |
| SMILES | CS(=O)(=O)N1CCC[C@@H](c2nc(-c3ccccc3I)no2)C1 |
| InChI | InChI=1S/C14H16IN3O3S/c1-22(19,20)18-8-4-5-10(9-18)14-16-13(17-21-14)11-6-2-3-7-12(11)15/h2-3,6-7,10H,4-5,8-9H2,1H3/t10-/m1/s1 |
| InChIKey | XHQANMWNEJWZTI-SNVBAGLBSA-N |
| XLogP | 2.48 |
| TPSA | 76.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.27 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|