C19H22ClN3O3S2 — CID 99969227
4-chloro-3-(4-methylpiperazin-1-yl)sulfonyl-N-(3-methylsulfanylphenyl)benzamide (PubChem CID 99969227) has the molecular formula C19H22ClN3O3S2 and a molecular weight of 439.99 g/mol. Its IUPAC name is 4-chloro-3-(4-methylpiperazin-1-yl)sulfonyl-N-(3-methylsulfanylphenyl)benzamide.
| Compound Name | 4-chloro-3-(4-methylpiperazin-1-yl)sulfonyl-N-(3-methylsulfanylphenyl)benzamide |
|---|---|
| PubChem CID | 99969227 |
| Molecular Formula | C19H22ClN3O3S2 |
| Molecular Weight | 439.99 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | 4-chloro-3-(4-methylpiperazin-1-yl)sulfonyl-N-(3-methylsulfanylphenyl)benzamide |
| SMILES | CSc1cccc(NC(=O)c2ccc(Cl)c(S(=O)(=O)N3CCN(C)CC3)c2)c1 |
| InChI | InChI=1S/C19H22ClN3O3S2/c1-22-8-10-23(11-9-22)28(25,26)18-12-14(6-7-17(18)20)19(24)21-15-4-3-5-16(13-15)27-2/h3-7,12-13H,8-11H2,1-2H3,(H,21,24) |
| InChIKey | VNXDSANVALUETF-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.99 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |