C16H22F2N2O2 — CID 99973199
(2R)-2-(2,5-difluorophenyl)-2-(4-propyl-1,4-diazepan-1-yl)acetic acid (PubChem CID 99973199) has the molecular formula C16H22F2N2O2 and a molecular weight of 312.36 g/mol. Its IUPAC name is (2R)-2-(2,5-difluorophenyl)-2-(4-propyl-1,4-diazepan-1-yl)acetic acid.
| Compound Name | (2R)-2-(2,5-difluorophenyl)-2-(4-propyl-1,4-diazepan-1-yl)acetic acid |
|---|---|
| PubChem CID | 99973199 |
| Molecular Formula | C16H22F2N2O2 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | (2R)-2-(2,5-difluorophenyl)-2-(4-propyl-1,4-diazepan-1-yl)acetic acid |
| SMILES | CCCN1CCCN([C@@H](C(=O)O)c2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C16H22F2N2O2/c1-2-6-19-7-3-8-20(10-9-19)15(16(21)22)13-11-12(17)4-5-14(13)18/h4-5,11,15H,2-3,6-10H2,1H3,(H,21,22)/t15-/m1/s1 |
| InChIKey | XBFYFENCKAMAFP-OAHLLOKOSA-N |
| XLogP | 2.51 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |