C20H20N4O2 — CID 99974769
1-[(2S)-2-pyridin-2-ylpiperidin-1-yl]-2-quinazolin-4-yloxyethanone (PubChem CID 99974769) has the molecular formula C20H20N4O2 and a molecular weight of 348.41 g/mol. Its IUPAC name is 1-[(2S)-2-pyridin-2-ylpiperidin-1-yl]-2-quinazolin-4-yloxyethanone.
| Compound Name | 1-[(2S)-2-pyridin-2-ylpiperidin-1-yl]-2-quinazolin-4-yloxyethanone |
|---|---|
| PubChem CID | 99974769 |
| Molecular Formula | C20H20N4O2 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 1-[(2S)-2-pyridin-2-ylpiperidin-1-yl]-2-quinazolin-4-yloxyethanone |
| SMILES | O=C(COc1ncnc2ccccc12)N1CCCC[C@H]1c1ccccn1 |
| InChI | InChI=1S/C20H20N4O2/c25-19(13-26-20-15-7-1-2-8-16(15)22-14-23-20)24-12-6-4-10-18(24)17-9-3-5-11-21-17/h1-3,5,7-9,11,14,18H,4,6,10,12-13H2/t18-/m0/s1 |
| InChIKey | MYTVLTPPXQWDQB-SFHVURJKSA-N |
| XLogP | 3.16 |
| TPSA | 68.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |