C18H18N4O2S — CID 91782874
2-quinazolin-4-yloxy-1-[2-(1,3-thiazol-2-yl)piperidin-1-yl]ethanone (PubChem CID 91782874) has the molecular formula C18H18N4O2S and a molecular weight of 354.44 g/mol. Its IUPAC name is 2-quinazolin-4-yloxy-1-[2-(1,3-thiazol-2-yl)piperidin-1-yl]ethanone.
| Compound Name | 2-quinazolin-4-yloxy-1-[2-(1,3-thiazol-2-yl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 91782874 |
| Molecular Formula | C18H18N4O2S |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 2-quinazolin-4-yloxy-1-[2-(1,3-thiazol-2-yl)piperidin-1-yl]ethanone |
| SMILES | O=C(COc1ncnc2ccccc12)N1CCCCC1c1nccs1 |
| InChI | InChI=1S/C18H18N4O2S/c23-16(22-9-4-3-7-15(22)18-19-8-10-25-18)11-24-17-13-5-1-2-6-14(13)20-12-21-17/h1-2,5-6,8,10,12,15H,3-4,7,9,11H2 |
| InChIKey | RNRQJAGEXCFCEZ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 68.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |