C18H22N2OS — CID 95770134
(3R)-3-phenyl-1-[(2S)-2-(1,3-thiazol-2-yl)piperidin-1-yl]butan-1-one (PubChem CID 95770134) has the molecular formula C18H22N2OS and a molecular weight of 314.45 g/mol. Its IUPAC name is (3R)-3-phenyl-1-[(2S)-2-(1,3-thiazol-2-yl)piperidin-1-yl]butan-1-one.
| Compound Name | (3R)-3-phenyl-1-[(2S)-2-(1,3-thiazol-2-yl)piperidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 95770134 |
| Molecular Formula | C18H22N2OS |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | (3R)-3-phenyl-1-[(2S)-2-(1,3-thiazol-2-yl)piperidin-1-yl]butan-1-one |
| SMILES | C[C@H](CC(=O)N1CCCC[C@H]1c1nccs1)c1ccccc1 |
| InChI | InChI=1S/C18H22N2OS/c1-14(15-7-3-2-4-8-15)13-17(21)20-11-6-5-9-16(20)18-19-10-12-22-18/h2-4,7-8,10,12,14,16H,5-6,9,11,13H2,1H3/t14-,16+/m1/s1 |
| InChIKey | AZRHEDBYFSMDCY-ZBFHGGJFSA-N |
| XLogP | 4.39 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |