About N-[2-oxo-2-[2-(1,3-thiazol-2-yl)piperidin-1-yl]ethyl]thiophene-2-sulfonamide
N-[2-oxo-2-[2-(1,3-thiazol-2-yl)piperidin-1-yl]ethyl]thiophene-2-sulfonamide (PubChem CID 91836688) has the molecular formula C14H17N3O3S3
and a molecular weight of 371.51 g/mol. Its IUPAC name is N-[2-oxo-2-[2-(1,3-thiazol-2-yl)piperidin-1-yl]ethyl]thiophene-2-sulfonamide.
Molecular Properties
| Compound Name | N-[2-oxo-2-[2-(1,3-thiazol-2-yl)piperidin-1-yl]ethyl]thiophene-2-sulfonamide |
| PubChem CID | 91836688 |
| Molecular Formula | C14H17N3O3S3 |
| Molecular Weight | 371.51 g/mol |
| Exact Mass | 371.04 |
| IUPAC Name | N-[2-oxo-2-[2-(1,3-thiazol-2-yl)piperidin-1-yl]ethyl]thiophene-2-sulfonamide |
| SMILES | O=C(CNS(=O)(=O)c1cccs1)N1CCCCC1c1nccs1 |
| InChI | InChI=1S/C14H17N3O3S3/c18-12(10-16-23(19,20)13-5-3-8-21-13)17-7-2-1-4-11(17)14-15-6-9-22-14/h3,5-6,8-9,11,16H,1-2,4,7,10H2 |
| InChIKey | DEHVVXOXGBMQBN-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.51 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[2-oxo-2-[2-(1,3-thiazol-2-yl)piperidin-1-yl]ethyl]thiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-oxo-2-[2-(1,3-thiazol-2-yl)piperidin-1-yl]ethyl]thiophene-2-sulfonamide?
The IUPAC name of N-[2-oxo-2-[2-(1,3-thiazol-2-yl)piperidin-1-yl]ethyl]thiophene-2-sulfonamide (CID 91836688) is N-[2-oxo-2-[2-(1,3-thiazol-2-yl)piperidin-1-yl]ethyl]thiophene-2-sulfonamide.
What is the SMILES notation for N-[2-oxo-2-[2-(1,3-thiazol-2-yl)piperidin-1-yl]ethyl]thiophene-2-sulfonamide?
The canonical SMILES for N-[2-oxo-2-[2-(1,3-thiazol-2-yl)piperidin-1-yl]ethyl]thiophene-2-sulfonamide is O=C(CNS(=O)(=O)c1cccs1)N1CCCCC1c1nccs1.
What is the InChIKey of N-[2-oxo-2-[2-(1,3-thiazol-2-yl)piperidin-1-yl]ethyl]thiophene-2-sulfonamide?
The InChIKey is DEHVVXOXGBMQBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3O3S3/c18-12(10-16-23(19,20)13-5-3-8-21-13)17-7-2-1-4-11(17)14-15-6-9-22-14/h3,5-6,8-9,11,16H,1-2,4,7,10H2.
What are the key properties of N-[2-oxo-2-[2-(1,3-thiazol-2-yl)piperidin-1-yl]ethyl]thiophene-2-sulfonamide?
N-[2-oxo-2-[2-(1,3-thiazol-2-yl)piperidin-1-yl]ethyl]thiophene-2-sulfonamide has a molecular weight of 371.51 g/mol, XLogP of 2.24, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-oxo-2-[2-(1,3-thiazol-2-yl)piperidin-1-yl]ethyl]thiophene-2-sulfonamide is sourced from PubChem (CID 91836688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).