C14H19N5O3S2 — CID 120879894
N-[2-[2-(1-methylimidazol-2-yl)piperazin-1-yl]-2-oxoethyl]thiophene-2-sulfonamide (PubChem CID 120879894) has the molecular formula C14H19N5O3S2 and a molecular weight of 369.47 g/mol. Its IUPAC name is N-[2-[2-(1-methylimidazol-2-yl)piperazin-1-yl]-2-oxoethyl]thiophene-2-sulfonamide.
| Compound Name | N-[2-[2-(1-methylimidazol-2-yl)piperazin-1-yl]-2-oxoethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 120879894 |
| Molecular Formula | C14H19N5O3S2 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | N-[2-[2-(1-methylimidazol-2-yl)piperazin-1-yl]-2-oxoethyl]thiophene-2-sulfonamide |
| SMILES | Cn1ccnc1C1CNCCN1C(=O)CNS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C14H19N5O3S2/c1-18-6-5-16-14(18)11-9-15-4-7-19(11)12(20)10-17-24(21,22)13-3-2-8-23-13/h2-3,5-6,8,11,15,17H,4,7,9-10H2,1H3 |
| InChIKey | LJOTUPUDWMUFQM-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |