C20H25N3O4S2 — CID 110200289
N-[2-oxo-2-(4-oxo-2-phenyl-1,5-diazecan-1-yl)ethyl]thiophene-2-sulfonamide (PubChem CID 110200289) has the molecular formula C20H25N3O4S2 and a molecular weight of 435.57 g/mol. Its IUPAC name is N-[2-oxo-2-(4-oxo-2-phenyl-1,5-diazecan-1-yl)ethyl]thiophene-2-sulfonamide.
| Compound Name | N-[2-oxo-2-(4-oxo-2-phenyl-1,5-diazecan-1-yl)ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 110200289 |
| Molecular Formula | C20H25N3O4S2 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | N-[2-oxo-2-(4-oxo-2-phenyl-1,5-diazecan-1-yl)ethyl]thiophene-2-sulfonamide |
| SMILES | O=C1CC(c2ccccc2)N(C(=O)CNS(=O)(=O)c2cccs2)CCCCCN1 |
| InChI | InChI=1S/C20H25N3O4S2/c24-18-14-17(16-8-3-1-4-9-16)23(12-6-2-5-11-21-18)19(25)15-22-29(26,27)20-10-7-13-28-20/h1,3-4,7-10,13,17,22H,2,5-6,11-12,14-15H2,(H,21,24) |
| InChIKey | ZTMKQHMURBNGIE-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |