C9H12FN3O2S — CID 99975396
2-(2-fluoro-N-methylsulfonylanilino)ethanimidamide (PubChem CID 99975396) has the molecular formula C9H12FN3O2S and a molecular weight of 245.28 g/mol. Its IUPAC name is 2-(2-fluoro-N-methylsulfonylanilino)ethanimidamide.
| Compound Name | 2-(2-fluoro-N-methylsulfonylanilino)ethanimidamide |
|---|---|
| PubChem CID | 99975396 |
| Molecular Formula | C9H12FN3O2S |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | 2-(2-fluoro-N-methylsulfonylanilino)ethanimidamide |
| SMILES | [H]/N=C(\N)CN(c1ccccc1F)S(C)(=O)=O |
| InChI | InChI=1S/C9H12FN3O2S/c1-16(14,15)13(6-9(11)12)8-5-3-2-4-7(8)10/h2-5H,6H2,1H3,(H3,11,12) |
| InChIKey | IXFLCLHZXWSWKC-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 87.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|