C21H17NO5 — CID 99975429
(1R,5R,6S,7R)-4-oxo-3-(4-phenoxyphenyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylic acid (PubChem CID 99975429) has the molecular formula C21H17NO5 and a molecular weight of 363.37 g/mol. Its IUPAC name is (1R,5R,6S,7R)-4-oxo-3-(4-phenoxyphenyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylic acid.
| Compound Name | (1R,5R,6S,7R)-4-oxo-3-(4-phenoxyphenyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylic acid |
|---|---|
| PubChem CID | 99975429 |
| Molecular Formula | C21H17NO5 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | (1R,5R,6S,7R)-4-oxo-3-(4-phenoxyphenyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylic acid |
| SMILES | O=C(O)[C@H]1[C@H]2C(=O)N(c3ccc(Oc4ccccc4)cc3)C[C@@]23C=C[C@H]1O3 |
| InChI | InChI=1S/C21H17NO5/c23-19-18-17(20(24)25)16-10-11-21(18,27-16)12-22(19)13-6-8-15(9-7-13)26-14-4-2-1-3-5-14/h1-11,16-18H,12H2,(H,24,25)/t16-,17-,18+,21+/m1/s1 |
| InChIKey | NWJPRZDCURYBDX-WIRSXHRWSA-N |
| XLogP | 2.85 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|