C15H12N2O6 — CID 11869754
(1S,5S,6R,7R)-3-(4-nitrophenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylic acid (PubChem CID 11869754) has the molecular formula C15H12N2O6 and a molecular weight of 316.27 g/mol. Its IUPAC name is (1S,5S,6R,7R)-3-(4-nitrophenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylic acid.
| Compound Name | (1S,5S,6R,7R)-3-(4-nitrophenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylic acid |
|---|---|
| PubChem CID | 11869754 |
| Molecular Formula | C15H12N2O6 |
| Molecular Weight | 316.27 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | (1S,5S,6R,7R)-3-(4-nitrophenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylic acid |
| SMILES | O=C(O)[C@H]1[C@H]2C=C[C@]3(CN(c4ccc([N+](=O)[O-])cc4)C(=O)[C@@H]13)O2 |
| InChI | InChI=1S/C15H12N2O6/c18-13-12-11(14(19)20)10-5-6-15(12,23-10)7-16(13)8-1-3-9(4-2-8)17(21)22/h1-6,10-12H,7H2,(H,19,20)/t10-,11+,12-,15-/m1/s1 |
| InChIKey | OABSTQQVOABLJC-NWJSVONSSA-N |
| XLogP | 0.97 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.27 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|