C15H11N2O6- — CID 7381151
(1S,5R,6R,7R)-3-(3-nitrophenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate (PubChem CID 7381151) has the molecular formula C15H11N2O6- and a molecular weight of 315.26 g/mol. Its IUPAC name is (1S,5R,6R,7R)-3-(3-nitrophenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate.
| Compound Name | (1S,5R,6R,7R)-3-(3-nitrophenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate |
|---|---|
| PubChem CID | 7381151 |
| Molecular Formula | C15H11N2O6- |
| Molecular Weight | 315.26 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | (1S,5R,6R,7R)-3-(3-nitrophenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate |
| SMILES | O=C([O-])[C@@H]1[C@H]2C(=O)N(c3cccc([N+](=O)[O-])c3)C[C@]23C=C[C@H]1O3 |
| InChI | InChI=1S/C15H12N2O6/c18-13-12-11(14(19)20)10-4-5-15(12,23-10)7-16(13)8-2-1-3-9(6-8)17(21)22/h1-6,10-12H,7H2,(H,19,20)/p-1/t10-,11+,12+,15-/m1/s1 |
| InChIKey | HGPZOPYXWPAUKK-OXJKWZBOSA-M |
| XLogP | -0.37 |
| TPSA | 112.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.26 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|