C13H15NO4S2 — CID 99975659
ethyl (3aS,9aS)-2,2-dioxo-1,3,3a,9a-tetrahydrothieno[3,4-b][1,4]benzothiazine-9-carboxylate (PubChem CID 99975659) has the molecular formula C13H15NO4S2 and a molecular weight of 313.40 g/mol. Its IUPAC name is ethyl (3aS,9aS)-2,2-dioxo-1,3,3a,9a-tetrahydrothieno[3,4-b][1,4]benzothiazine-9-carboxylate.
| Compound Name | ethyl (3aS,9aS)-2,2-dioxo-1,3,3a,9a-tetrahydrothieno[3,4-b][1,4]benzothiazine-9-carboxylate |
|---|---|
| PubChem CID | 99975659 |
| Molecular Formula | C13H15NO4S2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | ethyl (3aS,9aS)-2,2-dioxo-1,3,3a,9a-tetrahydrothieno[3,4-b][1,4]benzothiazine-9-carboxylate |
| SMILES | CCOC(=O)N1c2ccccc2S[C@@H]2CS(=O)(=O)C[C@@H]21 |
| InChI | InChI=1S/C13H15NO4S2/c1-2-18-13(15)14-9-5-3-4-6-11(9)19-12-8-20(16,17)7-10(12)14/h3-6,10,12H,2,7-8H2,1H3/t10-,12+/m0/s1 |
| InChIKey | XLZZRDWIADKFOT-CMPLNLGQSA-N |
| XLogP | 1.92 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |