C12H8Cl2N2O3 — CID 99976386
2-[(2,6-dichlorophenoxy)methyl]pyrimidine-5-carboxylic acid (PubChem CID 99976386) has the molecular formula C12H8Cl2N2O3 and a molecular weight of 299.11 g/mol. Its IUPAC name is 2-[(2,6-dichlorophenoxy)methyl]pyrimidine-5-carboxylic acid.
| Compound Name | 2-[(2,6-dichlorophenoxy)methyl]pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 99976386 |
| Molecular Formula | C12H8Cl2N2O3 |
| Molecular Weight | 299.11 g/mol |
| Exact Mass | 297.99 |
| IUPAC Name | 2-[(2,6-dichlorophenoxy)methyl]pyrimidine-5-carboxylic acid |
| SMILES | O=C(O)c1cnc(COc2c(Cl)cccc2Cl)nc1 |
| InChI | InChI=1S/C12H8Cl2N2O3/c13-8-2-1-3-9(14)11(8)19-6-10-15-4-7(5-16-10)12(17)18/h1-5H,6H2,(H,17,18) |
| InChIKey | ZDMAYLCETMRHMA-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.11 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |