2-[(2,3-dimethylphenoxy)methyl]pyrimidine-5-carboxylic acid

C14H14N2O3 — CID 82168712

IUPAC2-[(2,3-dimethylphenoxy)methyl]pyrimidine-5-carboxylic acid
SMILESCc1cccc(OCc2ncc(C(=O)O)cn2)c1C
InChIInChI=1S/C14H14N2O3/c1-9-4-3-5-12(10(9)2)19-8-13-15-6-11(7-16-13)14(17)18/h3-7H,8H2,1-2H3,(H,17,18)
InChIKeyLJBMBGZHBYXSGL-UHFFFAOYSA-N
MW258.28 g/mol
LogP2.37
Rot. Bonds4

About 2-[(2,3-dimethylphenoxy)methyl]pyrimidine-5-carboxylic acid

2-[(2,3-dimethylphenoxy)methyl]pyrimidine-5-carboxylic acid (PubChem CID 82168712) has the molecular formula C14H14N2O3 and a molecular weight of 258.28 g/mol. Its IUPAC name is 2-[(2,3-dimethylphenoxy)methyl]pyrimidine-5-carboxylic acid.

Molecular Properties

Compound Name2-[(2,3-dimethylphenoxy)methyl]pyrimidine-5-carboxylic acid
PubChem CID82168712
Molecular FormulaC14H14N2O3
Molecular Weight258.28 g/mol
Exact Mass258.10
IUPAC Name2-[(2,3-dimethylphenoxy)methyl]pyrimidine-5-carboxylic acid
SMILESCc1cccc(OCc2ncc(C(=O)O)cn2)c1C
InChIInChI=1S/C14H14N2O3/c1-9-4-3-5-12(10(9)2)19-8-13-15-6-11(7-16-13)14(17)18/h3-7H,8H2,1-2H3,(H,17,18)
InChIKeyLJBMBGZHBYXSGL-UHFFFAOYSA-N
XLogP2.37
TPSA72.31 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500258.28
LogP ≤ 52.37
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-[(2,3-dimethylphenoxy)methyl]pyrimidine-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(2,3-dimethylphenoxy)methyl]pyrimidine-5-carboxylic acid?
The IUPAC name of 2-[(2,3-dimethylphenoxy)methyl]pyrimidine-5-carboxylic acid (CID 82168712) is 2-[(2,3-dimethylphenoxy)methyl]pyrimidine-5-carboxylic acid.
What is the SMILES notation for 2-[(2,3-dimethylphenoxy)methyl]pyrimidine-5-carboxylic acid?
The canonical SMILES for 2-[(2,3-dimethylphenoxy)methyl]pyrimidine-5-carboxylic acid is Cc1cccc(OCc2ncc(C(=O)O)cn2)c1C.
What is the InChIKey of 2-[(2,3-dimethylphenoxy)methyl]pyrimidine-5-carboxylic acid?
The InChIKey is LJBMBGZHBYXSGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2O3/c1-9-4-3-5-12(10(9)2)19-8-13-15-6-11(7-16-13)14(17)18/h3-7H,8H2,1-2H3,(H,17,18).
What are the key properties of 2-[(2,3-dimethylphenoxy)methyl]pyrimidine-5-carboxylic acid?
2-[(2,3-dimethylphenoxy)methyl]pyrimidine-5-carboxylic acid has a molecular weight of 258.28 g/mol, XLogP of 2.37, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,3-dimethylphenoxy)methyl]pyrimidine-5-carboxylic acid is sourced from PubChem (CID 82168712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).