C18H24N4O4 — CID 99976509
4-[3-[2-[(1S)-1,2-dihydroxyethyl]-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl]propoxy]benzamide (PubChem CID 99976509) has the molecular formula C18H24N4O4 and a molecular weight of 360.41 g/mol. Its IUPAC name is 4-[3-[2-[(1S)-1,2-dihydroxyethyl]-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl]propoxy]benzamide.
| Compound Name | 4-[3-[2-[(1S)-1,2-dihydroxyethyl]-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl]propoxy]benzamide |
|---|---|
| PubChem CID | 99976509 |
| Molecular Formula | C18H24N4O4 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 4-[3-[2-[(1S)-1,2-dihydroxyethyl]-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl]propoxy]benzamide |
| SMILES | NC(=O)c1ccc(OCCCN2CCn3nc([C@H](O)CO)cc3C2)cc1 |
| InChI | InChI=1S/C18H24N4O4/c19-18(25)13-2-4-15(5-3-13)26-9-1-6-21-7-8-22-14(11-21)10-16(20-22)17(24)12-23/h2-5,10,17,23-24H,1,6-9,11-12H2,(H2,19,25)/t17-/m1/s1 |
| InChIKey | LAVMJBJERRLWET-QGZVFWFLSA-N |
| XLogP | 0.29 |
| TPSA | 113.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|