C11H19N3 — CID 99978633
1-ethyl-3,5-dimethyl-4-[(2R)-pyrrolidin-2-yl]pyrazole (PubChem CID 99978633) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is 1-ethyl-3,5-dimethyl-4-[(2R)-pyrrolidin-2-yl]pyrazole.
| Compound Name | 1-ethyl-3,5-dimethyl-4-[(2R)-pyrrolidin-2-yl]pyrazole |
|---|---|
| PubChem CID | 99978633 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | 1-ethyl-3,5-dimethyl-4-[(2R)-pyrrolidin-2-yl]pyrazole |
| SMILES | CCn1nc(C)c([C@H]2CCCN2)c1C |
| InChI | InChI=1S/C11H19N3/c1-4-14-9(3)11(8(2)13-14)10-6-5-7-12-10/h10,12H,4-7H2,1-3H3/t10-/m1/s1 |
| InChIKey | OWJVJDYZYPZIIQ-SNVBAGLBSA-N |
| XLogP | 1.94 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |