C9H14ClN3 — CID 95970426
5-chloro-1,3-dimethyl-4-[(2S)-pyrrolidin-2-yl]pyrazole (PubChem CID 95970426) has the molecular formula C9H14ClN3 and a molecular weight of 199.68 g/mol. Its IUPAC name is 5-chloro-1,3-dimethyl-4-[(2S)-pyrrolidin-2-yl]pyrazole.
| Compound Name | 5-chloro-1,3-dimethyl-4-[(2S)-pyrrolidin-2-yl]pyrazole |
|---|---|
| PubChem CID | 95970426 |
| Molecular Formula | C9H14ClN3 |
| Molecular Weight | 199.68 g/mol |
| Exact Mass | 199.09 |
| IUPAC Name | 5-chloro-1,3-dimethyl-4-[(2S)-pyrrolidin-2-yl]pyrazole |
| SMILES | Cc1nn(C)c(Cl)c1[C@@H]1CCCN1 |
| InChI | InChI=1S/C9H14ClN3/c1-6-8(7-4-3-5-11-7)9(10)13(2)12-6/h7,11H,3-5H2,1-2H3/t7-/m0/s1 |
| InChIKey | HNVLVORHMBKFKO-ZETCQYMHSA-N |
| XLogP | 1.81 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.68 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |