C15H18FNO4S — CID 99982042
methyl 2-[(3S)-1-[2-(4-fluorophenoxy)acetyl]pyrrolidin-3-yl]sulfanylacetate (PubChem CID 99982042) has the molecular formula C15H18FNO4S and a molecular weight of 327.38 g/mol. Its IUPAC name is methyl 2-[(3S)-1-[2-(4-fluorophenoxy)acetyl]pyrrolidin-3-yl]sulfanylacetate.
| Compound Name | methyl 2-[(3S)-1-[2-(4-fluorophenoxy)acetyl]pyrrolidin-3-yl]sulfanylacetate |
|---|---|
| PubChem CID | 99982042 |
| Molecular Formula | C15H18FNO4S |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | methyl 2-[(3S)-1-[2-(4-fluorophenoxy)acetyl]pyrrolidin-3-yl]sulfanylacetate |
| SMILES | COC(=O)CS[C@H]1CCN(C(=O)COc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C15H18FNO4S/c1-20-15(19)10-22-13-6-7-17(8-13)14(18)9-21-12-4-2-11(16)3-5-12/h2-5,13H,6-10H2,1H3/t13-/m0/s1 |
| InChIKey | AWXNZLDZYKEKOJ-ZDUSSCGKSA-N |
| XLogP | 1.71 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |