C14H15ClFNO3S — CID 99982058
methyl 2-[(3R)-1-(2-chloro-4-fluorobenzoyl)pyrrolidin-3-yl]sulfanylacetate (PubChem CID 99982058) has the molecular formula C14H15ClFNO3S and a molecular weight of 331.80 g/mol. Its IUPAC name is methyl 2-[(3R)-1-(2-chloro-4-fluorobenzoyl)pyrrolidin-3-yl]sulfanylacetate.
| Compound Name | methyl 2-[(3R)-1-(2-chloro-4-fluorobenzoyl)pyrrolidin-3-yl]sulfanylacetate |
|---|---|
| PubChem CID | 99982058 |
| Molecular Formula | C14H15ClFNO3S |
| Molecular Weight | 331.80 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | methyl 2-[(3R)-1-(2-chloro-4-fluorobenzoyl)pyrrolidin-3-yl]sulfanylacetate |
| SMILES | COC(=O)CS[C@@H]1CCN(C(=O)c2ccc(F)cc2Cl)C1 |
| InChI | InChI=1S/C14H15ClFNO3S/c1-20-13(18)8-21-10-4-5-17(7-10)14(19)11-3-2-9(16)6-12(11)15/h2-3,6,10H,4-5,7-8H2,1H3/t10-/m1/s1 |
| InChIKey | BPEPZWJFHALQIA-SNVBAGLBSA-N |
| XLogP | 2.60 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.80 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |