ethyl 2,2-difluoro-2-(1H-imidazol-2-ylsulfanyl)acetate

C7H8F2N2O2S — CID 99982872

IUPACethyl 2,2-difluoro-2-(1H-imidazol-2-ylsulfanyl)acetate
SMILESCCOC(=O)C(F)(F)Sc1ncc[nH]1
InChIInChI=1S/C7H8F2N2O2S/c1-2-13-5(12)7(8,9)14-6-10-3-4-11-6/h3-4H,2H2,1H3,(H,10,11)
InChIKeyAVIZSQJVURJZDS-UHFFFAOYSA-N
MW222.22 g/mol
LogP1.66
Rot. Bonds4

About ethyl 2,2-difluoro-2-(1H-imidazol-2-ylsulfanyl)acetate

ethyl 2,2-difluoro-2-(1H-imidazol-2-ylsulfanyl)acetate (PubChem CID 99982872) has the molecular formula C7H8F2N2O2S and a molecular weight of 222.22 g/mol. Its IUPAC name is ethyl 2,2-difluoro-2-(1H-imidazol-2-ylsulfanyl)acetate.

Molecular Properties

Compound Nameethyl 2,2-difluoro-2-(1H-imidazol-2-ylsulfanyl)acetate
PubChem CID99982872
Molecular FormulaC7H8F2N2O2S
Molecular Weight222.22 g/mol
Exact Mass222.03
IUPAC Nameethyl 2,2-difluoro-2-(1H-imidazol-2-ylsulfanyl)acetate
SMILESCCOC(=O)C(F)(F)Sc1ncc[nH]1
InChIInChI=1S/C7H8F2N2O2S/c1-2-13-5(12)7(8,9)14-6-10-3-4-11-6/h3-4H,2H2,1H3,(H,10,11)
InChIKeyAVIZSQJVURJZDS-UHFFFAOYSA-N
XLogP1.66
TPSA54.98 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500222.22
LogP ≤ 51.66
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze ethyl 2,2-difluoro-2-(1H-imidazol-2-ylsulfanyl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 2,2-difluoro-2-(1H-imidazol-2-ylsulfanyl)acetate?
The IUPAC name of ethyl 2,2-difluoro-2-(1H-imidazol-2-ylsulfanyl)acetate (CID 99982872) is ethyl 2,2-difluoro-2-(1H-imidazol-2-ylsulfanyl)acetate.
What is the SMILES notation for ethyl 2,2-difluoro-2-(1H-imidazol-2-ylsulfanyl)acetate?
The canonical SMILES for ethyl 2,2-difluoro-2-(1H-imidazol-2-ylsulfanyl)acetate is CCOC(=O)C(F)(F)Sc1ncc[nH]1.
What is the InChIKey of ethyl 2,2-difluoro-2-(1H-imidazol-2-ylsulfanyl)acetate?
The InChIKey is AVIZSQJVURJZDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8F2N2O2S/c1-2-13-5(12)7(8,9)14-6-10-3-4-11-6/h3-4H,2H2,1H3,(H,10,11).
What are the key properties of ethyl 2,2-difluoro-2-(1H-imidazol-2-ylsulfanyl)acetate?
ethyl 2,2-difluoro-2-(1H-imidazol-2-ylsulfanyl)acetate has a molecular weight of 222.22 g/mol, XLogP of 1.66, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2,2-difluoro-2-(1H-imidazol-2-ylsulfanyl)acetate is sourced from PubChem (CID 99982872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).