C7H8F2N2O2S — CID 99982872
ethyl 2,2-difluoro-2-(1H-imidazol-2-ylsulfanyl)acetate (PubChem CID 99982872) has the molecular formula C7H8F2N2O2S and a molecular weight of 222.22 g/mol. Its IUPAC name is ethyl 2,2-difluoro-2-(1H-imidazol-2-ylsulfanyl)acetate.
| Compound Name | ethyl 2,2-difluoro-2-(1H-imidazol-2-ylsulfanyl)acetate |
|---|---|
| PubChem CID | 99982872 |
| Molecular Formula | C7H8F2N2O2S |
| Molecular Weight | 222.22 g/mol |
| Exact Mass | 222.03 |
| IUPAC Name | ethyl 2,2-difluoro-2-(1H-imidazol-2-ylsulfanyl)acetate |
| SMILES | CCOC(=O)C(F)(F)Sc1ncc[nH]1 |
| InChI | InChI=1S/C7H8F2N2O2S/c1-2-13-5(12)7(8,9)14-6-10-3-4-11-6/h3-4H,2H2,1H3,(H,10,11) |
| InChIKey | AVIZSQJVURJZDS-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.22 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |