C20H26N2O3S — CID 99989815
(2R)-6-hydroxy-N,2,5,7,8-pentamethyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,4-dihydrochromene-2-carboxamide (PubChem CID 99989815) has the molecular formula C20H26N2O3S and a molecular weight of 374.51 g/mol. Its IUPAC name is (2R)-6-hydroxy-N,2,5,7,8-pentamethyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,4-dihydrochromene-2-carboxamide.
| Compound Name | (2R)-6-hydroxy-N,2,5,7,8-pentamethyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,4-dihydrochromene-2-carboxamide |
|---|---|
| PubChem CID | 99989815 |
| Molecular Formula | C20H26N2O3S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | (2R)-6-hydroxy-N,2,5,7,8-pentamethyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,4-dihydrochromene-2-carboxamide |
| SMILES | Cc1nc(CN(C)C(=O)[C@@]2(C)CCc3c(C)c(O)c(C)c(C)c3O2)cs1 |
| InChI | InChI=1S/C20H26N2O3S/c1-11-12(2)18-16(13(3)17(11)23)7-8-20(5,25-18)19(24)22(6)9-15-10-26-14(4)21-15/h10,23H,7-9H2,1-6H3/t20-/m1/s1 |
| InChIKey | AWAPSWBMUNBFKI-HXUWFJFHSA-N |
| XLogP | 3.82 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |