C7H13NO2S2 — CID 99997742
cis-(1S,3R)-3-methylsulfonylcyclopentane-1-carbothioamide (PubChem CID 99997742) has the molecular formula C7H13NO2S2 and a molecular weight of 207.32 g/mol. Its IUPAC name is cis-(1S,3R)-3-methylsulfonylcyclopentane-1-carbothioamide.
| Compound Name | cis-(1S,3R)-3-methylsulfonylcyclopentane-1-carbothioamide |
|---|---|
| PubChem CID | 99997742 |
| Molecular Formula | C7H13NO2S2 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.04 |
| IUPAC Name | cis-(1S,3R)-3-methylsulfonylcyclopentane-1-carbothioamide |
| SMILES | CS(=O)(=O)[C@@H]1CC[C@H](C(N)=S)C1 |
| InChI | InChI=1S/C7H13NO2S2/c1-12(9,10)6-3-2-5(4-6)7(8)11/h5-6H,2-4H2,1H3,(H2,8,11)/t5-,6+/m0/s1 |
| InChIKey | YEKMCNVZSUELSR-NTSWFWBYSA-N |
| XLogP | 0.49 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|