C12H20O5S2 — CID 113289682
(1,1-dioxothiolan-3-yl)-(3-methylsulfonylcyclohexyl)methanone (PubChem CID 113289682) has the molecular formula C12H20O5S2 and a molecular weight of 308.42 g/mol. Its IUPAC name is (1,1-dioxothiolan-3-yl)-(3-methylsulfonylcyclohexyl)methanone.
| Compound Name | (1,1-dioxothiolan-3-yl)-(3-methylsulfonylcyclohexyl)methanone |
|---|---|
| PubChem CID | 113289682 |
| Molecular Formula | C12H20O5S2 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | (1,1-dioxothiolan-3-yl)-(3-methylsulfonylcyclohexyl)methanone |
| SMILES | CS(=O)(=O)C1CCCC(C(=O)C2CCS(=O)(=O)C2)C1 |
| InChI | InChI=1S/C12H20O5S2/c1-18(14,15)11-4-2-3-9(7-11)12(13)10-5-6-19(16,17)8-10/h9-11H,2-8H2,1H3 |
| InChIKey | MZBAAMULPYMQQN-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |