C15H20N2O4S — CID 1989
View drug profile → acetohexamide1-(4-acetylphenyl)sulfonyl-3-cyclohexylurea (PubChem CID 1989) has the molecular formula C15H20N2O4S and a molecular weight of 324.40 g/mol. Its IUPAC name is 1-(4-acetylphenyl)sulfonyl-3-cyclohexylurea.
| Compound Name | 1-(4-acetylphenyl)sulfonyl-3-cyclohexylurea |
|---|---|
| PubChem CID | 1989 |
| Molecular Formula | C15H20N2O4S |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 1-(4-acetylphenyl)sulfonyl-3-cyclohexylurea |
| SMILES | CC(=O)c1ccc(S(=O)(=O)NC(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C15H20N2O4S/c1-11(18)12-7-9-14(10-8-12)22(20,21)17-15(19)16-13-5-3-2-4-6-13/h7-10,13H,2-6H2,1H3,(H2,16,17,19) |
| InChIKey | VGZSUPCWNCWDAN-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |